About 2-amino-N-[(E)-4-amino-5,5-difluoropent-2-enyl]acetamide
2-amino-N-[(E)-4-amino-5,5-difluoropent-2-enyl]acetamide (PubChem CID 88746935) has the molecular formula C7H13F2N3O
and a molecular weight of 193.20 g/mol. Its IUPAC name is 2-amino-N-[(E)-4-amino-5,5-difluoropent-2-enyl]acetamide.
Molecular Properties
| Compound Name | 2-amino-N-[(E)-4-amino-5,5-difluoropent-2-enyl]acetamide |
| PubChem CID | 88746935 |
| Molecular Formula | C7H13F2N3O |
| Molecular Weight | 193.20 g/mol |
| Exact Mass | 193.10 |
| IUPAC Name | 2-amino-N-[(E)-4-amino-5,5-difluoropent-2-enyl]acetamide |
| SMILES | NCC(=O)NC/C=C/C(N)C(F)F |
| InChI | InChI=1S/C7H13F2N3O/c8-7(9)5(11)2-1-3-12-6(13)4-10/h1-2,5,7H,3-4,10-11H2,(H,12,13)/b2-1+ |
| InChIKey | KVPPOMVFOUVMPU-OWOJBTEDSA-N |
| XLogP | -0.79 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.20 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-N-[(E)-4-amino-5,5-difluoropent-2-enyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-N-[(E)-4-amino-5,5-difluoropent-2-enyl]acetamide?
The IUPAC name of 2-amino-N-[(E)-4-amino-5,5-difluoropent-2-enyl]acetamide (CID 88746935) is 2-amino-N-[(E)-4-amino-5,5-difluoropent-2-enyl]acetamide.
What is the SMILES notation for 2-amino-N-[(E)-4-amino-5,5-difluoropent-2-enyl]acetamide?
The canonical SMILES for 2-amino-N-[(E)-4-amino-5,5-difluoropent-2-enyl]acetamide is NCC(=O)NC/C=C/C(N)C(F)F.
What is the InChIKey of 2-amino-N-[(E)-4-amino-5,5-difluoropent-2-enyl]acetamide?
The InChIKey is KVPPOMVFOUVMPU-OWOJBTEDSA-N. The full InChI is InChI=1S/C7H13F2N3O/c8-7(9)5(11)2-1-3-12-6(13)4-10/h1-2,5,7H,3-4,10-11H2,(H,12,13)/b2-1+.
What are the key properties of 2-amino-N-[(E)-4-amino-5,5-difluoropent-2-enyl]acetamide?
2-amino-N-[(E)-4-amino-5,5-difluoropent-2-enyl]acetamide has a molecular weight of 193.20 g/mol, XLogP of -0.79, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-N-[(E)-4-amino-5,5-difluoropent-2-enyl]acetamide is sourced from PubChem (CID 88746935), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).