C30H44O4S — CID 88747803
[(1E,3E,7E)-9,9-diethoxy-3,7-dimethyl-1-(2,6,6-trimethylcyclohexen-1-yl)nona-1,3,7-trien-5-yl]sulfonylbenzene (PubChem CID 88747803) has the molecular formula C30H44O4S and a molecular weight of 500.75 g/mol. Its IUPAC name is [(1E,3E,7E)-9,9-diethoxy-3,7-dimethyl-1-(2,6,6-trimethylcyclohexen-1-yl)nona-1,3,7-trien-5-yl]sulfonylbenzene.
| Compound Name | [(1E,3E,7E)-9,9-diethoxy-3,7-dimethyl-1-(2,6,6-trimethylcyclohexen-1-yl)nona-1,3,7-trien-5-yl]sulfonylbenzene |
|---|---|
| PubChem CID | 88747803 |
| Molecular Formula | C30H44O4S |
| Molecular Weight | 500.75 g/mol |
| Exact Mass | 500.30 |
| IUPAC Name | [(1E,3E,7E)-9,9-diethoxy-3,7-dimethyl-1-(2,6,6-trimethylcyclohexen-1-yl)nona-1,3,7-trien-5-yl]sulfonylbenzene |
| SMILES | CCOC(/C=C(\C)CC(/C=C(C)/C=C/C1=C(C)CCCC1(C)C)S(=O)(=O)c1ccccc1)OCC |
| InChI | InChI=1S/C30H44O4S/c1-8-33-29(34-9-2)22-24(4)21-27(35(31,32)26-15-11-10-12-16-26)20-23(3)17-18-28-25(5)14-13-19-30(28,6)7/h10-12,15-18,20,22,27,29H,8-9,13-14,19,21H2,1-7H3/b18-17+,23-20+,24-22+ |
| InChIKey | DBTNUNHDULEIBL-MBHQVEJISA-N |
| XLogP | 7.59 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.75 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|