About 1-(3-fluorophenyl)-4,5-dihydroimidazol-1-ium-1-carbothioamide
1-(3-fluorophenyl)-4,5-dihydroimidazol-1-ium-1-carbothioamide (PubChem CID 88747818) has the molecular formula C10H11FN3S+
and a molecular weight of 224.28 g/mol. Its IUPAC name is 1-(3-fluorophenyl)-4,5-dihydroimidazol-1-ium-1-carbothioamide.
Molecular Properties
| Compound Name | 1-(3-fluorophenyl)-4,5-dihydroimidazol-1-ium-1-carbothioamide |
| PubChem CID | 88747818 |
| Molecular Formula | C10H11FN3S+ |
| Molecular Weight | 224.28 g/mol |
| Exact Mass | 224.07 |
| IUPAC Name | 1-(3-fluorophenyl)-4,5-dihydroimidazol-1-ium-1-carbothioamide |
| SMILES | NC(=S)[N+]1(c2cccc(F)c2)C=NCC1 |
| InChI | InChI=1S/C10H10FN3S/c11-8-2-1-3-9(6-8)14(10(12)15)5-4-13-7-14/h1-3,6-7H,4-5H2,(H-,12,15)/p+1 |
| InChIKey | AHGCBYUBGVUYFJ-UHFFFAOYSA-O |
| XLogP | 1.42 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.28 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-(3-fluorophenyl)-4,5-dihydroimidazol-1-ium-1-carbothioamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-fluorophenyl)-4,5-dihydroimidazol-1-ium-1-carbothioamide?
The IUPAC name of 1-(3-fluorophenyl)-4,5-dihydroimidazol-1-ium-1-carbothioamide (CID 88747818) is 1-(3-fluorophenyl)-4,5-dihydroimidazol-1-ium-1-carbothioamide.
What is the SMILES notation for 1-(3-fluorophenyl)-4,5-dihydroimidazol-1-ium-1-carbothioamide?
The canonical SMILES for 1-(3-fluorophenyl)-4,5-dihydroimidazol-1-ium-1-carbothioamide is NC(=S)[N+]1(c2cccc(F)c2)C=NCC1.
What is the InChIKey of 1-(3-fluorophenyl)-4,5-dihydroimidazol-1-ium-1-carbothioamide?
The InChIKey is AHGCBYUBGVUYFJ-UHFFFAOYSA-O. The full InChI is InChI=1S/C10H10FN3S/c11-8-2-1-3-9(6-8)14(10(12)15)5-4-13-7-14/h1-3,6-7H,4-5H2,(H-,12,15)/p+1.
What are the key properties of 1-(3-fluorophenyl)-4,5-dihydroimidazol-1-ium-1-carbothioamide?
1-(3-fluorophenyl)-4,5-dihydroimidazol-1-ium-1-carbothioamide has a molecular weight of 224.28 g/mol, XLogP of 1.42, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-fluorophenyl)-4,5-dihydroimidazol-1-ium-1-carbothioamide is sourced from PubChem (CID 88747818), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).