C11H16F3N5O2S — CID 88748329
5-[3-[sulfanyl(2,2,2-trifluoroethylcarbamoyl)amino]pyrazol-1-yl]pentanamide (PubChem CID 88748329) has the molecular formula C11H16F3N5O2S and a molecular weight of 339.34 g/mol. Its IUPAC name is 5-[3-[sulfanyl(2,2,2-trifluoroethylcarbamoyl)amino]pyrazol-1-yl]pentanamide.
| Compound Name | 5-[3-[sulfanyl(2,2,2-trifluoroethylcarbamoyl)amino]pyrazol-1-yl]pentanamide |
|---|---|
| PubChem CID | 88748329 |
| Molecular Formula | C11H16F3N5O2S |
| Molecular Weight | 339.34 g/mol |
| Exact Mass | 339.10 |
| IUPAC Name | 5-[3-[sulfanyl(2,2,2-trifluoroethylcarbamoyl)amino]pyrazol-1-yl]pentanamide |
| SMILES | NC(=O)CCCCn1ccc(N(S)C(=O)NCC(F)(F)F)n1 |
| InChI | InChI=1S/C11H16F3N5O2S/c12-11(13,14)7-16-10(21)19(22)9-4-6-18(17-9)5-2-1-3-8(15)20/h4,6,22H,1-3,5,7H2,(H2,15,20)(H,16,21) |
| InChIKey | AVZZEURLFDXKOC-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 93.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.34 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|