C22H26ClNO3S — CID 88748982
[(2S,7S,9aS)-7-(2-chlorophenyl)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-2-yl] 4-methylbenzenesulfonate (PubChem CID 88748982) has the molecular formula C22H26ClNO3S and a molecular weight of 419.97 g/mol. Its IUPAC name is [(2S,7S,9aS)-7-(2-chlorophenyl)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-2-yl] 4-methylbenzenesulfonate.
| Compound Name | [(2S,7S,9aS)-7-(2-chlorophenyl)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-2-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 88748982 |
| Molecular Formula | C22H26ClNO3S |
| Molecular Weight | 419.97 g/mol |
| Exact Mass | 419.13 |
| IUPAC Name | [(2S,7S,9aS)-7-(2-chlorophenyl)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-2-yl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)O[C@H]2CCN3C[C@H](c4ccccc4Cl)CC[C@H]3C2)cc1 |
| InChI | InChI=1S/C22H26ClNO3S/c1-16-6-10-20(11-7-16)28(25,26)27-19-12-13-24-15-17(8-9-18(24)14-19)21-4-2-3-5-22(21)23/h2-7,10-11,17-19H,8-9,12-15H2,1H3/t17-,18+,19+/m1/s1 |
| InChIKey | UBSSFCNKVYPOJV-QYZOEREBSA-N |
| XLogP | 4.76 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.97 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|