About 2-(1-methylcyclohexa-2,4-dien-1-yl)oxirane
2-(1-methylcyclohexa-2,4-dien-1-yl)oxirane (PubChem CID 88749065) has the molecular formula C9H12O
and a molecular weight of 136.19 g/mol. Its IUPAC name is 2-(1-methylcyclohexa-2,4-dien-1-yl)oxirane.
Molecular Properties
| Compound Name | 2-(1-methylcyclohexa-2,4-dien-1-yl)oxirane |
| PubChem CID | 88749065 |
| Molecular Formula | C9H12O |
| Molecular Weight | 136.19 g/mol |
| Exact Mass | 136.09 |
| IUPAC Name | 2-(1-methylcyclohexa-2,4-dien-1-yl)oxirane |
| SMILES | CC1(C2CO2)C=CC=CC1 |
| InChI | InChI=1S/C9H12O/c1-9(8-7-10-8)5-3-2-4-6-9/h2-5,8H,6-7H2,1H3 |
| InChIKey | FBBBLIJKOIWMSW-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.19 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 2-(1-methylcyclohexa-2,4-dien-1-yl)oxirane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-methylcyclohexa-2,4-dien-1-yl)oxirane?
The IUPAC name of 2-(1-methylcyclohexa-2,4-dien-1-yl)oxirane (CID 88749065) is 2-(1-methylcyclohexa-2,4-dien-1-yl)oxirane.
What is the SMILES notation for 2-(1-methylcyclohexa-2,4-dien-1-yl)oxirane?
The canonical SMILES for 2-(1-methylcyclohexa-2,4-dien-1-yl)oxirane is CC1(C2CO2)C=CC=CC1.
What is the InChIKey of 2-(1-methylcyclohexa-2,4-dien-1-yl)oxirane?
The InChIKey is FBBBLIJKOIWMSW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12O/c1-9(8-7-10-8)5-3-2-4-6-9/h2-5,8H,6-7H2,1H3.
What are the key properties of 2-(1-methylcyclohexa-2,4-dien-1-yl)oxirane?
2-(1-methylcyclohexa-2,4-dien-1-yl)oxirane has a molecular weight of 136.19 g/mol, XLogP of 1.91, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-methylcyclohexa-2,4-dien-1-yl)oxirane is sourced from PubChem (CID 88749065), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).