About dimethyl-[(E)-(6-methyl-4-oxo-7,8-dihydro-6H-pyrido[1,2-a]pyrimidin-9-ylidene)methyl]azanium dichloride
dimethyl-[(E)-(6-methyl-4-oxo-7,8-dihydro-6H-pyrido[1,2-a]pyrimidin-9-ylidene)methyl]azanium dichloride (PubChem CID 88749457) has the molecular formula C12H18Cl2N3O-
and a molecular weight of 291.20 g/mol. Its IUPAC name is dimethyl-[(E)-(6-methyl-4-oxo-7,8-dihydro-6H-pyrido[1,2-a]pyrimidin-9-ylidene)methyl]azanium dichloride.
Molecular Properties
| Compound Name | dimethyl-[(E)-(6-methyl-4-oxo-7,8-dihydro-6H-pyrido[1,2-a]pyrimidin-9-ylidene)methyl]azanium dichloride |
| PubChem CID | 88749457 |
| Molecular Formula | C12H18Cl2N3O- |
| Molecular Weight | 291.20 g/mol |
| Exact Mass | 290.08 |
| IUPAC Name | dimethyl-[(E)-(6-methyl-4-oxo-7,8-dihydro-6H-pyrido[1,2-a]pyrimidin-9-ylidene)methyl]azanium dichloride |
| SMILES | CC1CC/C(=C\[NH+](C)C)c2nccc(=O)n21.[Cl-].[Cl-] |
| InChI | InChI=1S/C12H17N3O.2ClH/c1-9-4-5-10(8-14(2)3)12-13-7-6-11(16)15(9)12;;/h6-9H,4-5H2,1-3H3;2*1H/p-1/b10-8+;; |
| InChIKey | KKUPQTFNVOJITM-PIHABLKOSA-M |
| XLogP | -5.91 |
| TPSA | 39.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.20 |
| LogP ≤ 5 | -5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze dimethyl-[(E)-(6-methyl-4-oxo-7,8-dihydro-6H-pyrido[1,2-a]pyrimidin-9-ylidene)methyl]azanium dichloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl-[(E)-(6-methyl-4-oxo-7,8-dihydro-6H-pyrido[1,2-a]pyrimidin-9-ylidene)methyl]azanium dichloride?
The IUPAC name of dimethyl-[(E)-(6-methyl-4-oxo-7,8-dihydro-6H-pyrido[1,2-a]pyrimidin-9-ylidene)methyl]azanium dichloride (CID 88749457) is dimethyl-[(E)-(6-methyl-4-oxo-7,8-dihydro-6H-pyrido[1,2-a]pyrimidin-9-ylidene)methyl]azanium dichloride.
What is the SMILES notation for dimethyl-[(E)-(6-methyl-4-oxo-7,8-dihydro-6H-pyrido[1,2-a]pyrimidin-9-ylidene)methyl]azanium dichloride?
The canonical SMILES for dimethyl-[(E)-(6-methyl-4-oxo-7,8-dihydro-6H-pyrido[1,2-a]pyrimidin-9-ylidene)methyl]azanium dichloride is CC1CC/C(=C\[NH+](C)C)c2nccc(=O)n21.[Cl-].[Cl-].
What is the InChIKey of dimethyl-[(E)-(6-methyl-4-oxo-7,8-dihydro-6H-pyrido[1,2-a]pyrimidin-9-ylidene)methyl]azanium dichloride?
The InChIKey is KKUPQTFNVOJITM-PIHABLKOSA-M. The full InChI is InChI=1S/C12H17N3O.2ClH/c1-9-4-5-10(8-14(2)3)12-13-7-6-11(16)15(9)12;;/h6-9H,4-5H2,1-3H3;2*1H/p-1/b10-8+;;.
What are the key properties of dimethyl-[(E)-(6-methyl-4-oxo-7,8-dihydro-6H-pyrido[1,2-a]pyrimidin-9-ylidene)methyl]azanium dichloride?
dimethyl-[(E)-(6-methyl-4-oxo-7,8-dihydro-6H-pyrido[1,2-a]pyrimidin-9-ylidene)methyl]azanium dichloride has a molecular weight of 291.20 g/mol, XLogP of -5.91, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl-[(E)-(6-methyl-4-oxo-7,8-dihydro-6H-pyrido[1,2-a]pyrimidin-9-ylidene)methyl]azanium dichloride is sourced from PubChem (CID 88749457), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).