About azane;N-prop-2-enylpent-1-en-3-amine
azane;N-prop-2-enylpent-1-en-3-amine (PubChem CID 88749494) has the molecular formula C8H21N3
and a molecular weight of 159.28 g/mol. Its IUPAC name is azane;N-prop-2-enylpent-1-en-3-amine.
Molecular Properties
| Compound Name | azane;N-prop-2-enylpent-1-en-3-amine |
| PubChem CID | 88749494 |
| Molecular Formula | C8H21N3 |
| Molecular Weight | 159.28 g/mol |
| Exact Mass | 159.17 |
| IUPAC Name | azane;N-prop-2-enylpent-1-en-3-amine |
| SMILES | C=CCNC(C=C)CC.N.N |
| InChI | InChI=1S/C8H15N.2H3N/c1-4-7-9-8(5-2)6-3;;/h4-5,8-9H,1-2,6-7H2,3H3;2*1H3 |
| InChIKey | OBKMNZYNTBGCDM-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 82.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.28 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze azane;N-prop-2-enylpent-1-en-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;N-prop-2-enylpent-1-en-3-amine?
The IUPAC name of azane;N-prop-2-enylpent-1-en-3-amine (CID 88749494) is azane;N-prop-2-enylpent-1-en-3-amine.
What is the SMILES notation for azane;N-prop-2-enylpent-1-en-3-amine?
The canonical SMILES for azane;N-prop-2-enylpent-1-en-3-amine is C=CCNC(C=C)CC.N.N.
What is the InChIKey of azane;N-prop-2-enylpent-1-en-3-amine?
The InChIKey is OBKMNZYNTBGCDM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15N.2H3N/c1-4-7-9-8(5-2)6-3;;/h4-5,8-9H,1-2,6-7H2,3H3;2*1H3.
What are the key properties of azane;N-prop-2-enylpent-1-en-3-amine?
azane;N-prop-2-enylpent-1-en-3-amine has a molecular weight of 159.28 g/mol, XLogP of 2.05, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for azane;N-prop-2-enylpent-1-en-3-amine is sourced from PubChem (CID 88749494), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).