C3H6N4OS — CID 88749957
4-amino-3-sulfanyl-2,3-dihydro-1,2,4-triazin-5-one (PubChem CID 88749957) has the molecular formula C3H6N4OS and a molecular weight of 146.18 g/mol. Its IUPAC name is 4-amino-3-sulfanyl-2,3-dihydro-1,2,4-triazin-5-one.
| Compound Name | 4-amino-3-sulfanyl-2,3-dihydro-1,2,4-triazin-5-one |
|---|---|
| PubChem CID | 88749957 |
| Molecular Formula | C3H6N4OS |
| Molecular Weight | 146.18 g/mol |
| Exact Mass | 146.03 |
| IUPAC Name | 4-amino-3-sulfanyl-2,3-dihydro-1,2,4-triazin-5-one |
| SMILES | NN1C(=O)C=NNC1S |
| InChI | InChI=1S/C3H6N4OS/c4-7-2(8)1-5-6-3(7)9/h1,3,6,9H,4H2 |
| InChIKey | AKEYRTWWTLSLIA-UHFFFAOYSA-N |
| XLogP | -1.51 |
| TPSA | 70.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.18 |
| LogP ≤ 5 | -1.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|