C11H21N3O5S — CID 88750270
3-prop-2-enyl-1-sulfanyl-1-[[3,4,5-trihydroxy-2-(hydroxymethyl)piperidin-2-yl]methyl]urea (PubChem CID 88750270) has the molecular formula C11H21N3O5S and a molecular weight of 307.37 g/mol. Its IUPAC name is 3-prop-2-enyl-1-sulfanyl-1-[[3,4,5-trihydroxy-2-(hydroxymethyl)piperidin-2-yl]methyl]urea.
| Compound Name | 3-prop-2-enyl-1-sulfanyl-1-[[3,4,5-trihydroxy-2-(hydroxymethyl)piperidin-2-yl]methyl]urea |
|---|---|
| PubChem CID | 88750270 |
| Molecular Formula | C11H21N3O5S |
| Molecular Weight | 307.37 g/mol |
| Exact Mass | 307.12 |
| IUPAC Name | 3-prop-2-enyl-1-sulfanyl-1-[[3,4,5-trihydroxy-2-(hydroxymethyl)piperidin-2-yl]methyl]urea |
| SMILES | C=CCNC(=O)N(S)CC1(CO)NCC(O)C(O)C1O |
| InChI | InChI=1S/C11H21N3O5S/c1-2-3-12-10(19)14(20)5-11(6-15)9(18)8(17)7(16)4-13-11/h2,7-9,13,15-18,20H,1,3-6H2,(H,12,19) |
| InChIKey | PQXFRZFDAUEJKZ-UHFFFAOYSA-N |
| XLogP | -2.55 |
| TPSA | 125.29 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.37 |
| LogP ≤ 5 | -2.55 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|