C9H15N5O2 — CID 88750347
(2E)-2-hydroxyimino-N,3-dimethyl-3-(1,2,4-triazol-1-yl)pentanamide (PubChem CID 88750347) has the molecular formula C9H15N5O2 and a molecular weight of 225.25 g/mol. Its IUPAC name is (2E)-2-hydroxyimino-N,3-dimethyl-3-(1,2,4-triazol-1-yl)pentanamide.
| Compound Name | (2E)-2-hydroxyimino-N,3-dimethyl-3-(1,2,4-triazol-1-yl)pentanamide |
|---|---|
| PubChem CID | 88750347 |
| Molecular Formula | C9H15N5O2 |
| Molecular Weight | 225.25 g/mol |
| Exact Mass | 225.12 |
| IUPAC Name | (2E)-2-hydroxyimino-N,3-dimethyl-3-(1,2,4-triazol-1-yl)pentanamide |
| SMILES | CCC(C)(/C(=N\O)C(=O)NC)n1cncn1 |
| InChI | InChI=1S/C9H15N5O2/c1-4-9(2,14-6-11-5-12-14)7(13-16)8(15)10-3/h5-6,16H,4H2,1-3H3,(H,10,15)/b13-7- |
| InChIKey | YVXIEXUYQZESLK-QPEQYQDCSA-N |
| XLogP | -0.02 |
| TPSA | 92.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.25 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|