C15H28F3N3O3 — CID 88750400
N-[2-[4-(1,1-diethoxypropyl)piperazin-1-yl]ethyl]-2,2,2-trifluoroacetamide (PubChem CID 88750400) has the molecular formula C15H28F3N3O3 and a molecular weight of 355.40 g/mol. Its IUPAC name is N-[2-[4-(1,1-diethoxypropyl)piperazin-1-yl]ethyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[2-[4-(1,1-diethoxypropyl)piperazin-1-yl]ethyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 88750400 |
| Molecular Formula | C15H28F3N3O3 |
| Molecular Weight | 355.40 g/mol |
| Exact Mass | 355.21 |
| IUPAC Name | N-[2-[4-(1,1-diethoxypropyl)piperazin-1-yl]ethyl]-2,2,2-trifluoroacetamide |
| SMILES | CCOC(CC)(OCC)N1CCN(CCNC(=O)C(F)(F)F)CC1 |
| InChI | InChI=1S/C15H28F3N3O3/c1-4-14(23-5-2,24-6-3)21-11-9-20(10-12-21)8-7-19-13(22)15(16,17)18/h4-12H2,1-3H3,(H,19,22) |
| InChIKey | ONXKYGULLAZVPC-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.40 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|