About potassium;4,5-dichloro-2-benzofuran-1,3-dione;fluoride
potassium;4,5-dichloro-2-benzofuran-1,3-dione;fluoride (PubChem CID 88750823) has the molecular formula C8H2Cl2FKO3
and a molecular weight of 275.10 g/mol. Its IUPAC name is potassium;4,5-dichloro-2-benzofuran-1,3-dione;fluoride.
Molecular Properties
| Compound Name | potassium;4,5-dichloro-2-benzofuran-1,3-dione;fluoride |
| PubChem CID | 88750823 |
| Molecular Formula | C8H2Cl2FKO3 |
| Molecular Weight | 275.10 g/mol |
| Exact Mass | 273.90 |
| IUPAC Name | potassium;4,5-dichloro-2-benzofuran-1,3-dione;fluoride |
| SMILES | O=C1OC(=O)c2c1ccc(Cl)c2Cl.[F-].[K+] |
| InChI | InChI=1S/C8H2Cl2O3.FH.K/c9-4-2-1-3-5(6(4)10)8(12)13-7(3)11;;/h1-2H;1H;/q;;+1/p-1 |
| InChIKey | FDSCLUNTMMJSTQ-UHFFFAOYSA-M |
| XLogP | -3.69 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.10 |
| LogP ≤ 5 | -3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze potassium;4,5-dichloro-2-benzofuran-1,3-dione;fluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium;4,5-dichloro-2-benzofuran-1,3-dione;fluoride?
The IUPAC name of potassium;4,5-dichloro-2-benzofuran-1,3-dione;fluoride (CID 88750823) is potassium;4,5-dichloro-2-benzofuran-1,3-dione;fluoride.
What is the SMILES notation for potassium;4,5-dichloro-2-benzofuran-1,3-dione;fluoride?
The canonical SMILES for potassium;4,5-dichloro-2-benzofuran-1,3-dione;fluoride is O=C1OC(=O)c2c1ccc(Cl)c2Cl.[F-].[K+].
What is the InChIKey of potassium;4,5-dichloro-2-benzofuran-1,3-dione;fluoride?
The InChIKey is FDSCLUNTMMJSTQ-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H2Cl2O3.FH.K/c9-4-2-1-3-5(6(4)10)8(12)13-7(3)11;;/h1-2H;1H;/q;;+1/p-1.
What are the key properties of potassium;4,5-dichloro-2-benzofuran-1,3-dione;fluoride?
potassium;4,5-dichloro-2-benzofuran-1,3-dione;fluoride has a molecular weight of 275.10 g/mol, XLogP of -3.69, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for potassium;4,5-dichloro-2-benzofuran-1,3-dione;fluoride is sourced from PubChem (CID 88750823), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).