About ethene;oxolane-2,5-dione
ethene;oxolane-2,5-dione (PubChem CID 88750918) has the molecular formula C8H12O3
and a molecular weight of 156.18 g/mol. Its IUPAC name is ethene;oxolane-2,5-dione.
Molecular Properties
| Compound Name | ethene;oxolane-2,5-dione |
| PubChem CID | 88750918 |
| Molecular Formula | C8H12O3 |
| Molecular Weight | 156.18 g/mol |
| Exact Mass | 156.08 |
| IUPAC Name | ethene;oxolane-2,5-dione |
| SMILES | C=C.C=C.O=C1CCC(=O)O1 |
| InChI | InChI=1S/C4H4O3.2C2H4/c5-3-1-2-4(6)7-3;2*1-2/h1-2H2;2*1-2H2 |
| InChIKey | KTVSXAJZSVOSBT-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.18 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethene;oxolane-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethene;oxolane-2,5-dione?
The IUPAC name of ethene;oxolane-2,5-dione (CID 88750918) is ethene;oxolane-2,5-dione.
What is the SMILES notation for ethene;oxolane-2,5-dione?
The canonical SMILES for ethene;oxolane-2,5-dione is C=C.C=C.O=C1CCC(=O)O1.
What is the InChIKey of ethene;oxolane-2,5-dione?
The InChIKey is KTVSXAJZSVOSBT-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H4O3.2C2H4/c5-3-1-2-4(6)7-3;2*1-2/h1-2H2;2*1-2H2.
What are the key properties of ethene;oxolane-2,5-dione?
ethene;oxolane-2,5-dione has a molecular weight of 156.18 g/mol, XLogP of 1.45, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethene;oxolane-2,5-dione is sourced from PubChem (CID 88750918), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).