About tert-butyl 5-amino-4-(1-ethoxy-1,3-dioxopropan-2-yl)-1,3-thiazole-2-carboxylate
tert-butyl 5-amino-4-(1-ethoxy-1,3-dioxopropan-2-yl)-1,3-thiazole-2-carboxylate (PubChem CID 88751373) has the molecular formula C13H18N2O5S
and a molecular weight of 314.36 g/mol. Its IUPAC name is tert-butyl 5-amino-4-(1-ethoxy-1,3-dioxopropan-2-yl)-1,3-thiazole-2-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 5-amino-4-(1-ethoxy-1,3-dioxopropan-2-yl)-1,3-thiazole-2-carboxylate |
| PubChem CID | 88751373 |
| Molecular Formula | C13H18N2O5S |
| Molecular Weight | 314.36 g/mol |
| Exact Mass | 314.09 |
| IUPAC Name | tert-butyl 5-amino-4-(1-ethoxy-1,3-dioxopropan-2-yl)-1,3-thiazole-2-carboxylate |
| SMILES | CCOC(=O)C(C=O)c1nc(C(=O)OC(C)(C)C)sc1N |
| InChI | InChI=1S/C13H18N2O5S/c1-5-19-11(17)7(6-16)8-9(14)21-10(15-8)12(18)20-13(2,3)4/h6-7H,5,14H2,1-4H3 |
| InChIKey | ZZRXHJHHSBDREL-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 108.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.36 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 5-amino-4-(1-ethoxy-1,3-dioxopropan-2-yl)-1,3-thiazole-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 5-amino-4-(1-ethoxy-1,3-dioxopropan-2-yl)-1,3-thiazole-2-carboxylate?
The IUPAC name of tert-butyl 5-amino-4-(1-ethoxy-1,3-dioxopropan-2-yl)-1,3-thiazole-2-carboxylate (CID 88751373) is tert-butyl 5-amino-4-(1-ethoxy-1,3-dioxopropan-2-yl)-1,3-thiazole-2-carboxylate.
What is the SMILES notation for tert-butyl 5-amino-4-(1-ethoxy-1,3-dioxopropan-2-yl)-1,3-thiazole-2-carboxylate?
The canonical SMILES for tert-butyl 5-amino-4-(1-ethoxy-1,3-dioxopropan-2-yl)-1,3-thiazole-2-carboxylate is CCOC(=O)C(C=O)c1nc(C(=O)OC(C)(C)C)sc1N.
What is the InChIKey of tert-butyl 5-amino-4-(1-ethoxy-1,3-dioxopropan-2-yl)-1,3-thiazole-2-carboxylate?
The InChIKey is ZZRXHJHHSBDREL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18N2O5S/c1-5-19-11(17)7(6-16)8-9(14)21-10(15-8)12(18)20-13(2,3)4/h6-7H,5,14H2,1-4H3.
What are the key properties of tert-butyl 5-amino-4-(1-ethoxy-1,3-dioxopropan-2-yl)-1,3-thiazole-2-carboxylate?
tert-butyl 5-amino-4-(1-ethoxy-1,3-dioxopropan-2-yl)-1,3-thiazole-2-carboxylate has a molecular weight of 314.36 g/mol, XLogP of 1.53, 5 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 5-amino-4-(1-ethoxy-1,3-dioxopropan-2-yl)-1,3-thiazole-2-carboxylate is sourced from PubChem (CID 88751373), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).