About acetic acid;N,N-dimethylformamide;ethanol
acetic acid;N,N-dimethylformamide;ethanol (PubChem CID 88751459) has the molecular formula C7H17NO4
and a molecular weight of 179.22 g/mol. Its IUPAC name is acetic acid;N,N-dimethylformamide;ethanol.
Molecular Properties
| Compound Name | acetic acid;N,N-dimethylformamide;ethanol |
| PubChem CID | 88751459 |
| Molecular Formula | C7H17NO4 |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.12 |
| IUPAC Name | acetic acid;N,N-dimethylformamide;ethanol |
| SMILES | CC(=O)O.CCO.CN(C)C=O |
| InChI | InChI=1S/C3H7NO.C2H4O2.C2H6O/c1-4(2)3-5;1-2(3)4;1-2-3/h3H,1-2H3;1H3,(H,3,4);3H,2H2,1H3 |
| InChIKey | UVSMPXZOOQOBDM-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze acetic acid;N,N-dimethylformamide;ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetic acid;N,N-dimethylformamide;ethanol?
The IUPAC name of acetic acid;N,N-dimethylformamide;ethanol (CID 88751459) is acetic acid;N,N-dimethylformamide;ethanol.
What is the SMILES notation for acetic acid;N,N-dimethylformamide;ethanol?
The canonical SMILES for acetic acid;N,N-dimethylformamide;ethanol is CC(=O)O.CCO.CN(C)C=O.
What is the InChIKey of acetic acid;N,N-dimethylformamide;ethanol?
The InChIKey is UVSMPXZOOQOBDM-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H7NO.C2H4O2.C2H6O/c1-4(2)3-5;1-2(3)4;1-2-3/h3H,1-2H3;1H3,(H,3,4);3H,2H2,1H3.
What are the key properties of acetic acid;N,N-dimethylformamide;ethanol?
acetic acid;N,N-dimethylformamide;ethanol has a molecular weight of 179.22 g/mol, XLogP of -0.21, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;N,N-dimethylformamide;ethanol is sourced from PubChem (CID 88751459), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).