About 1-[6-[2-(dimethylamino)propoxy]acridin-3-yl]oxy-N,N-dimethylpropan-2-amine;iron
1-[6-[2-(dimethylamino)propoxy]acridin-3-yl]oxy-N,N-dimethylpropan-2-amine;iron (PubChem CID 88751664) has the molecular formula C23H31FeN3O2
and a molecular weight of 437.37 g/mol. Its IUPAC name is 1-[6-[2-(dimethylamino)propoxy]acridin-3-yl]oxy-N,N-dimethylpropan-2-amine;iron.
Molecular Properties
| Compound Name | 1-[6-[2-(dimethylamino)propoxy]acridin-3-yl]oxy-N,N-dimethylpropan-2-amine;iron |
| PubChem CID | 88751664 |
| Molecular Formula | C23H31FeN3O2 |
| Molecular Weight | 437.37 g/mol |
| Exact Mass | 437.18 |
| IUPAC Name | 1-[6-[2-(dimethylamino)propoxy]acridin-3-yl]oxy-N,N-dimethylpropan-2-amine;iron |
| SMILES | CC(COc1ccc2cc3ccc(OCC(C)N(C)C)cc3nc2c1)N(C)C.[Fe] |
| InChI | InChI=1S/C23H31N3O2.Fe/c1-16(25(3)4)14-27-20-9-7-18-11-19-8-10-21(28-15-17(2)26(5)6)13-23(19)24-22(18)12-20;/h7-13,16-17H,14-15H2,1-6H3; |
| InChIKey | HYKUZGJGHHPPRN-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 37.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 437.37 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 1-[6-[2-(dimethylamino)propoxy]acridin-3-yl]oxy-N,N-dimethylpropan-2-amine;iron with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[6-[2-(dimethylamino)propoxy]acridin-3-yl]oxy-N,N-dimethylpropan-2-amine;iron?
The IUPAC name of 1-[6-[2-(dimethylamino)propoxy]acridin-3-yl]oxy-N,N-dimethylpropan-2-amine;iron (CID 88751664) is 1-[6-[2-(dimethylamino)propoxy]acridin-3-yl]oxy-N,N-dimethylpropan-2-amine;iron.
What is the SMILES notation for 1-[6-[2-(dimethylamino)propoxy]acridin-3-yl]oxy-N,N-dimethylpropan-2-amine;iron?
The canonical SMILES for 1-[6-[2-(dimethylamino)propoxy]acridin-3-yl]oxy-N,N-dimethylpropan-2-amine;iron is CC(COc1ccc2cc3ccc(OCC(C)N(C)C)cc3nc2c1)N(C)C.[Fe].
What is the InChIKey of 1-[6-[2-(dimethylamino)propoxy]acridin-3-yl]oxy-N,N-dimethylpropan-2-amine;iron?
The InChIKey is HYKUZGJGHHPPRN-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H31N3O2.Fe/c1-16(25(3)4)14-27-20-9-7-18-11-19-8-10-21(28-15-17(2)26(5)6)13-23(19)24-22(18)12-20;/h7-13,16-17H,14-15H2,1-6H3;.
What are the key properties of 1-[6-[2-(dimethylamino)propoxy]acridin-3-yl]oxy-N,N-dimethylpropan-2-amine;iron?
1-[6-[2-(dimethylamino)propoxy]acridin-3-yl]oxy-N,N-dimethylpropan-2-amine;iron has a molecular weight of 437.37 g/mol, XLogP of 4.04, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[6-[2-(dimethylamino)propoxy]acridin-3-yl]oxy-N,N-dimethylpropan-2-amine;iron is sourced from PubChem (CID 88751664), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).