C13H18N8O4S2 — CID 88752112
(Z)-but-2-enedioic acid;1-cyano-2-[2-[[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]methylsulfanyl]ethyl]guanidine (PubChem CID 88752112) has the molecular formula C13H18N8O4S2 and a molecular weight of 414.47 g/mol. Its IUPAC name is (Z)-but-2-enedioic acid;1-cyano-2-[2-[[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]methylsulfanyl]ethyl]guanidine.
| Compound Name | (Z)-but-2-enedioic acid;1-cyano-2-[2-[[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]methylsulfanyl]ethyl]guanidine |
|---|---|
| PubChem CID | 88752112 |
| Molecular Formula | C13H18N8O4S2 |
| Molecular Weight | 414.47 g/mol |
| Exact Mass | 414.09 |
| IUPAC Name | (Z)-but-2-enedioic acid;1-cyano-2-[2-[[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]methylsulfanyl]ethyl]guanidine |
| SMILES | N#CN/C(N)=N/CCSCc1csc(N=C(N)N)n1.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C9H14N8S2.C4H4O4/c10-5-15-8(13)14-1-2-18-3-6-4-19-9(16-6)17-7(11)12;5-3(6)1-2-4(7)8/h4H,1-3H2,(H3,13,14,15)(H4,11,12,16,17);1-2H,(H,5,6)(H,7,8)/b;2-1- |
| InChIKey | ASXNVLMLBVSWSU-BTJKTKAUSA-N |
| XLogP | -0.62 |
| TPSA | 226.09 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.47 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|