C21H36O7S — CID 88752374
1,1-diethoxyethane;ethene;[1-(4-methoxyphenyl)-3-methyl-1-oxobutan-2-yl] methanesulfonate (PubChem CID 88752374) has the molecular formula C21H36O7S and a molecular weight of 432.58 g/mol. Its IUPAC name is 1,1-diethoxyethane;ethene;[1-(4-methoxyphenyl)-3-methyl-1-oxobutan-2-yl] methanesulfonate.
| Compound Name | 1,1-diethoxyethane;ethene;[1-(4-methoxyphenyl)-3-methyl-1-oxobutan-2-yl] methanesulfonate |
|---|---|
| PubChem CID | 88752374 |
| Molecular Formula | C21H36O7S |
| Molecular Weight | 432.58 g/mol |
| Exact Mass | 432.22 |
| IUPAC Name | 1,1-diethoxyethane;ethene;[1-(4-methoxyphenyl)-3-methyl-1-oxobutan-2-yl] methanesulfonate |
| SMILES | C=C.CCOC(C)OCC.COc1ccc(C(=O)C(OS(C)(=O)=O)C(C)C)cc1 |
| InChI | InChI=1S/C13H18O5S.C6H14O2.C2H4/c1-9(2)13(18-19(4,15)16)12(14)10-5-7-11(17-3)8-6-10;1-4-7-6(3)8-5-2;1-2/h5-9,13H,1-4H3;6H,4-5H2,1-3H3;1-2H2 |
| InChIKey | VFHHIUVFJWHDJY-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.58 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|