About N-[1-(3,5-dichlorophenyl)-2,5-dioxopyrrolidin-3-yl]-N-prop-2-enoxyformamide
N-[1-(3,5-dichlorophenyl)-2,5-dioxopyrrolidin-3-yl]-N-prop-2-enoxyformamide (PubChem CID 88752656) has the molecular formula C14H12Cl2N2O4
and a molecular weight of 343.17 g/mol. Its IUPAC name is N-[1-(3,5-dichlorophenyl)-2,5-dioxopyrrolidin-3-yl]-N-prop-2-enoxyformamide.
Molecular Properties
| Compound Name | N-[1-(3,5-dichlorophenyl)-2,5-dioxopyrrolidin-3-yl]-N-prop-2-enoxyformamide |
| PubChem CID | 88752656 |
| Molecular Formula | C14H12Cl2N2O4 |
| Molecular Weight | 343.17 g/mol |
| Exact Mass | 342.02 |
| IUPAC Name | N-[1-(3,5-dichlorophenyl)-2,5-dioxopyrrolidin-3-yl]-N-prop-2-enoxyformamide |
| SMILES | C=CCON(C=O)C1CC(=O)N(c2cc(Cl)cc(Cl)c2)C1=O |
| InChI | InChI=1S/C14H12Cl2N2O4/c1-2-3-22-17(8-19)12-7-13(20)18(14(12)21)11-5-9(15)4-10(16)6-11/h2,4-6,8,12H,1,3,7H2 |
| InChIKey | AMISGSYBSDTVGJ-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.17 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze N-[1-(3,5-dichlorophenyl)-2,5-dioxopyrrolidin-3-yl]-N-prop-2-enoxyformamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-(3,5-dichlorophenyl)-2,5-dioxopyrrolidin-3-yl]-N-prop-2-enoxyformamide?
The IUPAC name of N-[1-(3,5-dichlorophenyl)-2,5-dioxopyrrolidin-3-yl]-N-prop-2-enoxyformamide (CID 88752656) is N-[1-(3,5-dichlorophenyl)-2,5-dioxopyrrolidin-3-yl]-N-prop-2-enoxyformamide.
What is the SMILES notation for N-[1-(3,5-dichlorophenyl)-2,5-dioxopyrrolidin-3-yl]-N-prop-2-enoxyformamide?
The canonical SMILES for N-[1-(3,5-dichlorophenyl)-2,5-dioxopyrrolidin-3-yl]-N-prop-2-enoxyformamide is C=CCON(C=O)C1CC(=O)N(c2cc(Cl)cc(Cl)c2)C1=O.
What is the InChIKey of N-[1-(3,5-dichlorophenyl)-2,5-dioxopyrrolidin-3-yl]-N-prop-2-enoxyformamide?
The InChIKey is AMISGSYBSDTVGJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12Cl2N2O4/c1-2-3-22-17(8-19)12-7-13(20)18(14(12)21)11-5-9(15)4-10(16)6-11/h2,4-6,8,12H,1,3,7H2.
What are the key properties of N-[1-(3,5-dichlorophenyl)-2,5-dioxopyrrolidin-3-yl]-N-prop-2-enoxyformamide?
N-[1-(3,5-dichlorophenyl)-2,5-dioxopyrrolidin-3-yl]-N-prop-2-enoxyformamide has a molecular weight of 343.17 g/mol, XLogP of 2.20, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-(3,5-dichlorophenyl)-2,5-dioxopyrrolidin-3-yl]-N-prop-2-enoxyformamide is sourced from PubChem (CID 88752656), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).