C12H13Cl3O3 — CID 88752669
carbonochloridic acid;1-(2,2-dichlorocyclopropyl)-4-ethoxybenzene (PubChem CID 88752669) has the molecular formula C12H13Cl3O3 and a molecular weight of 311.59 g/mol. Its IUPAC name is carbonochloridic acid;1-(2,2-dichlorocyclopropyl)-4-ethoxybenzene.
| Compound Name | carbonochloridic acid;1-(2,2-dichlorocyclopropyl)-4-ethoxybenzene |
|---|---|
| PubChem CID | 88752669 |
| Molecular Formula | C12H13Cl3O3 |
| Molecular Weight | 311.59 g/mol |
| Exact Mass | 309.99 |
| IUPAC Name | carbonochloridic acid;1-(2,2-dichlorocyclopropyl)-4-ethoxybenzene |
| SMILES | CCOc1ccc(C2CC2(Cl)Cl)cc1.O=C(O)Cl |
| InChI | InChI=1S/C11H12Cl2O.CHClO2/c1-2-14-9-5-3-8(4-6-9)10-7-11(10,12)13;2-1(3)4/h3-6,10H,2,7H2,1H3;(H,3,4) |
| InChIKey | IWGPANTZYOUPJQ-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.59 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|