C21H31NO — CID 88753113
N-[3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenyl]formamide (PubChem CID 88753113) has the molecular formula C21H31NO and a molecular weight of 313.49 g/mol. Its IUPAC name is N-[3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenyl]formamide.
| Compound Name | N-[3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenyl]formamide |
|---|---|
| PubChem CID | 88753113 |
| Molecular Formula | C21H31NO |
| Molecular Weight | 313.49 g/mol |
| Exact Mass | 313.24 |
| IUPAC Name | N-[3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenyl]formamide |
| SMILES | CC(C=CC1=C(C)CCCC1(C)C)=CC=CC(C)=CCNC=O |
| InChI | InChI=1S/C21H31NO/c1-17(8-6-9-18(2)13-15-22-16-23)11-12-20-19(3)10-7-14-21(20,4)5/h6,8-9,11-13,16H,7,10,14-15H2,1-5H3,(H,22,23) |
| InChIKey | BHBKHVOLLYHFCN-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.49 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|