C9H17ClO2 — CID 88753593
4-chloro-1,1-diethoxy-2-methylbut-2-ene (PubChem CID 88753593) has the molecular formula C9H17ClO2 and a molecular weight of 192.69 g/mol. Its IUPAC name is 4-chloro-1,1-diethoxy-2-methylbut-2-ene.
| Compound Name | 4-chloro-1,1-diethoxy-2-methylbut-2-ene |
|---|---|
| PubChem CID | 88753593 |
| Molecular Formula | C9H17ClO2 |
| Molecular Weight | 192.69 g/mol |
| Exact Mass | 192.09 |
| IUPAC Name | 4-chloro-1,1-diethoxy-2-methylbut-2-ene |
| SMILES | CCOC(OCC)C(C)=CCCl |
| InChI | InChI=1S/C9H17ClO2/c1-4-11-9(12-5-2)8(3)6-7-10/h6,9H,4-5,7H2,1-3H3 |
| InChIKey | CGDHTIAGYOVFKX-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.69 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|