C34H25ClO6Se — CID 88753999
4-[(2,6-diphenylpyran-4-ylidene)methyl]-2,6-diphenyl-1-oxonia-2λ4-selenacyclohexa-1,3,5-triene perchlorate (PubChem CID 88753999) has the molecular formula C34H25ClO6Se and a molecular weight of 643.98 g/mol. Its IUPAC name is 4-[(2,6-diphenylpyran-4-ylidene)methyl]-2,6-diphenyl-1-oxonia-2λ4-selenacyclohexa-1,3,5-triene perchlorate.
| Compound Name | 4-[(2,6-diphenylpyran-4-ylidene)methyl]-2,6-diphenyl-1-oxonia-2λ4-selenacyclohexa-1,3,5-triene perchlorate |
|---|---|
| PubChem CID | 88753999 |
| Molecular Formula | C34H25ClO6Se |
| Molecular Weight | 643.98 g/mol |
| Exact Mass | 644.05 |
| IUPAC Name | 4-[(2,6-diphenylpyran-4-ylidene)methyl]-2,6-diphenyl-1-oxonia-2λ4-selenacyclohexa-1,3,5-triene perchlorate |
| SMILES | C(=C1C=C(c2ccccc2)OC(c2ccccc2)=C1)C1=C[Se](c2ccccc2)=[O+]C(c2ccccc2)=C1.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C34H25O2Se.ClHO4/c1-5-13-28(14-6-1)32-22-26(23-33(35-32)29-15-7-2-8-16-29)21-27-24-34(30-17-9-3-10-18-30)36-37(25-27)31-19-11-4-12-20-31;2-1(3,4)5/h1-25H;(H,2,3,4,5)/q+1;/p-1 |
| InChIKey | BKQXYDRCZRVLTL-UHFFFAOYSA-M |
| XLogP | 2.65 |
| TPSA | 112.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.98 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|