About diethylazanium;N,N-dimethylcarbamodithioate
diethylazanium;N,N-dimethylcarbamodithioate (PubChem CID 88754344) has the molecular formula C7H18N2S2
and a molecular weight of 194.37 g/mol. Its IUPAC name is diethylazanium;N,N-dimethylcarbamodithioate.
Molecular Properties
| Compound Name | diethylazanium;N,N-dimethylcarbamodithioate |
| PubChem CID | 88754344 |
| Molecular Formula | C7H18N2S2 |
| Molecular Weight | 194.37 g/mol |
| Exact Mass | 194.09 |
| IUPAC Name | diethylazanium;N,N-dimethylcarbamodithioate |
| SMILES | CC[NH2+]CC.CN(C)C(=S)[S-] |
| InChI | InChI=1S/C4H11N.C3H7NS2/c1-3-5-4-2;1-4(2)3(5)6/h5H,3-4H2,1-2H3;1-2H3,(H,5,6) |
| InChIKey | PLPBMTZPVNVYRN-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 19.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.37 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze diethylazanium;N,N-dimethylcarbamodithioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethylazanium;N,N-dimethylcarbamodithioate?
The IUPAC name of diethylazanium;N,N-dimethylcarbamodithioate (CID 88754344) is diethylazanium;N,N-dimethylcarbamodithioate.
What is the SMILES notation for diethylazanium;N,N-dimethylcarbamodithioate?
The canonical SMILES for diethylazanium;N,N-dimethylcarbamodithioate is CC[NH2+]CC.CN(C)C(=S)[S-].
What is the InChIKey of diethylazanium;N,N-dimethylcarbamodithioate?
The InChIKey is PLPBMTZPVNVYRN-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H11N.C3H7NS2/c1-3-5-4-2;1-4(2)3(5)6/h5H,3-4H2,1-2H3;1-2H3,(H,5,6).
What are the key properties of diethylazanium;N,N-dimethylcarbamodithioate?
diethylazanium;N,N-dimethylcarbamodithioate has a molecular weight of 194.37 g/mol, XLogP of -0.03, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for diethylazanium;N,N-dimethylcarbamodithioate is sourced from PubChem (CID 88754344), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).