About 1-(ethylaminooxy)-N,N-dimethylethanamine
1-(ethylaminooxy)-N,N-dimethylethanamine (PubChem CID 88754370) has the molecular formula C6H16N2O
and a molecular weight of 132.21 g/mol. Its IUPAC name is 1-(ethylaminooxy)-N,N-dimethylethanamine.
Molecular Properties
| Compound Name | 1-(ethylaminooxy)-N,N-dimethylethanamine |
| PubChem CID | 88754370 |
| Molecular Formula | C6H16N2O |
| Molecular Weight | 132.21 g/mol |
| Exact Mass | 132.13 |
| IUPAC Name | 1-(ethylaminooxy)-N,N-dimethylethanamine |
| SMILES | CCNOC(C)N(C)C |
| InChI | InChI=1S/C6H16N2O/c1-5-7-9-6(2)8(3)4/h6-7H,5H2,1-4H3 |
| InChIKey | OLLLDFQQVMYLRZ-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.21 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-(ethylaminooxy)-N,N-dimethylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(ethylaminooxy)-N,N-dimethylethanamine?
The IUPAC name of 1-(ethylaminooxy)-N,N-dimethylethanamine (CID 88754370) is 1-(ethylaminooxy)-N,N-dimethylethanamine.
What is the SMILES notation for 1-(ethylaminooxy)-N,N-dimethylethanamine?
The canonical SMILES for 1-(ethylaminooxy)-N,N-dimethylethanamine is CCNOC(C)N(C)C.
What is the InChIKey of 1-(ethylaminooxy)-N,N-dimethylethanamine?
The InChIKey is OLLLDFQQVMYLRZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H16N2O/c1-5-7-9-6(2)8(3)4/h6-7H,5H2,1-4H3.
What are the key properties of 1-(ethylaminooxy)-N,N-dimethylethanamine?
1-(ethylaminooxy)-N,N-dimethylethanamine has a molecular weight of 132.21 g/mol, XLogP of 0.44, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(ethylaminooxy)-N,N-dimethylethanamine is sourced from PubChem (CID 88754370), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).