C16H35N3O4 — CID 88754419
2-[2-hydroxyethoxy-[3-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]propyl]amino]oxyethanol (PubChem CID 88754419) has the molecular formula C16H35N3O4 and a molecular weight of 333.47 g/mol. Its IUPAC name is 2-[2-hydroxyethoxy-[3-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]propyl]amino]oxyethanol.
| Compound Name | 2-[2-hydroxyethoxy-[3-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]propyl]amino]oxyethanol |
|---|---|
| PubChem CID | 88754419 |
| Molecular Formula | C16H35N3O4 |
| Molecular Weight | 333.47 g/mol |
| Exact Mass | 333.26 |
| IUPAC Name | 2-[2-hydroxyethoxy-[3-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]propyl]amino]oxyethanol |
| SMILES | CC1(C)CC(NCCCN(OCCO)OCCO)CC(C)(C)N1 |
| InChI | InChI=1S/C16H35N3O4/c1-15(2)12-14(13-16(3,4)18-15)17-6-5-7-19(22-10-8-20)23-11-9-21/h14,17-18,20-21H,5-13H2,1-4H3 |
| InChIKey | PGTDLSLWJUNGOY-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 86.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.47 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|