C28H41FO8 — CID 88754472
(6S,8S,9S,10R,13S,14S,17R)-6-fluoro-11,17-dihydroxy-17-[2-[hydroxy(dipropoxy)methoxy]acetyl]-10,13-dimethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-one (PubChem CID 88754472) has the molecular formula C28H41FO8 and a molecular weight of 524.63 g/mol. Its IUPAC name is (6S,8S,9S,10R,13S,14S,17R)-6-fluoro-11,17-dihydroxy-17-[2-[hydroxy(dipropoxy)methoxy]acetyl]-10,13-dimethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-one.
| Compound Name | (6S,8S,9S,10R,13S,14S,17R)-6-fluoro-11,17-dihydroxy-17-[2-[hydroxy(dipropoxy)methoxy]acetyl]-10,13-dimethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 88754472 |
| Molecular Formula | C28H41FO8 |
| Molecular Weight | 524.63 g/mol |
| Exact Mass | 524.28 |
| IUPAC Name | (6S,8S,9S,10R,13S,14S,17R)-6-fluoro-11,17-dihydroxy-17-[2-[hydroxy(dipropoxy)methoxy]acetyl]-10,13-dimethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-one |
| SMILES | CCCOC(O)(OCCC)OCC(=O)[C@@]1(O)CC[C@H]2[C@@H]3C[C@H](F)C4=CC(=O)C=C[C@]4(C)[C@H]3C(O)C[C@@]21C |
| InChI | InChI=1S/C28H41FO8/c1-5-11-35-28(34,36-12-6-2)37-16-23(32)27(33)10-8-19-18-14-21(29)20-13-17(30)7-9-25(20,3)24(18)22(31)15-26(19,27)4/h7,9,13,18-19,21-22,24,31,33-34H,5-6,8,10-12,14-16H2,1-4H3/t18-,19-,21-,22?,24+,25-,26-,27-/m0/s1 |
| InChIKey | BDKVIMCRMNIJDY-WIDCEIGQSA-N |
| XLogP | 2.99 |
| TPSA | 122.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.63 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|