C11H25ClN2O — CID 88754733
1,3-bis(tert-butylamino)propan-2-one;hydrochloride (PubChem CID 88754733) has the molecular formula C11H25ClN2O and a molecular weight of 236.79 g/mol. Its IUPAC name is 1,3-bis(tert-butylamino)propan-2-one;hydrochloride.
| Compound Name | 1,3-bis(tert-butylamino)propan-2-one;hydrochloride |
|---|---|
| PubChem CID | 88754733 |
| Molecular Formula | C11H25ClN2O |
| Molecular Weight | 236.79 g/mol |
| Exact Mass | 236.17 |
| IUPAC Name | 1,3-bis(tert-butylamino)propan-2-one;hydrochloride |
| SMILES | CC(C)(C)NCC(=O)CNC(C)(C)C.Cl |
| InChI | InChI=1S/C11H24N2O.ClH/c1-10(2,3)12-7-9(14)8-13-11(4,5)6;/h12-13H,7-8H2,1-6H3;1H |
| InChIKey | USUFFSULPIFJPZ-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.79 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |