C25H32N3O2+ — CID 8875501
cyclopentyl-[2-[(3R)-3-(4-methoxyphenyl)-5-phenyl-3,4-dihydropyrazol-2-yl]-2-oxoethyl]-dimethylazanium (PubChem CID 8875501) has the molecular formula C25H32N3O2+ and a molecular weight of 406.55 g/mol. Its IUPAC name is cyclopentyl-[2-[(3R)-3-(4-methoxyphenyl)-5-phenyl-3,4-dihydropyrazol-2-yl]-2-oxoethyl]-dimethylazanium.
| Compound Name | cyclopentyl-[2-[(3R)-3-(4-methoxyphenyl)-5-phenyl-3,4-dihydropyrazol-2-yl]-2-oxoethyl]-dimethylazanium |
|---|---|
| PubChem CID | 8875501 |
| Molecular Formula | C25H32N3O2+ |
| Molecular Weight | 406.55 g/mol |
| Exact Mass | 406.25 |
| IUPAC Name | cyclopentyl-[2-[(3R)-3-(4-methoxyphenyl)-5-phenyl-3,4-dihydropyrazol-2-yl]-2-oxoethyl]-dimethylazanium |
| SMILES | COc1ccc([C@H]2CC(c3ccccc3)=NN2C(=O)C[N+](C)(C)C2CCCC2)cc1 |
| InChI | InChI=1S/C25H32N3O2/c1-28(2,21-11-7-8-12-21)18-25(29)27-24(20-13-15-22(30-3)16-14-20)17-23(26-27)19-9-5-4-6-10-19/h4-6,9-10,13-16,21,24H,7-8,11-12,17-18H2,1-3H3/q+1/t24-/m1/s1 |
| InChIKey | KCYHOWAJJXMBBN-XMMPIXPASA-N |
| XLogP | 4.39 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.55 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|