C26H23NO3S — CID 88755312
4-methyl-6-(4-sulfinylbutoxy)-1H-quinolin-2-one;2-phenylbicyclo[3.1.0]hexa-1,3,5-triene (PubChem CID 88755312) has the molecular formula C26H23NO3S and a molecular weight of 429.54 g/mol. Its IUPAC name is 4-methyl-6-(4-sulfinylbutoxy)-1H-quinolin-2-one;2-phenylbicyclo[3.1.0]hexa-1,3,5-triene.
| Compound Name | 4-methyl-6-(4-sulfinylbutoxy)-1H-quinolin-2-one;2-phenylbicyclo[3.1.0]hexa-1,3,5-triene |
|---|---|
| PubChem CID | 88755312 |
| Molecular Formula | C26H23NO3S |
| Molecular Weight | 429.54 g/mol |
| Exact Mass | 429.14 |
| IUPAC Name | 4-methyl-6-(4-sulfinylbutoxy)-1H-quinolin-2-one;2-phenylbicyclo[3.1.0]hexa-1,3,5-triene |
| SMILES | Cc1cc(=O)[nH]c2ccc(OCCCC=S=O)cc12.c1ccc(-c2ccc3cc2-3)cc1 |
| InChI | InChI=1S/C14H15NO3S.C12H8/c1-10-8-14(16)15-13-5-4-11(9-12(10)13)18-6-2-3-7-19-17;1-2-4-9(5-3-1)11-7-6-10-8-12(10)11/h4-5,7-9H,2-3,6H2,1H3,(H,15,16);1-8H |
| InChIKey | DTTZWEZQNAJVQI-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 59.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.54 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|