(E,2E)-2-hydroxyiminopent-3-enoic acid

C5H7NO3 — CID 88755648

IUPAC(E,2E)-2-hydroxyiminopent-3-enoic acid
SMILESC/C=C/C(=N\O)C(=O)O
InChIInChI=1S/C5H7NO3/c1-2-3-4(6-9)5(7)8/h2-3,9H,1H3,(H,7,8)/b3-2+,6-4+
InChIKeyMJMZCXUAGYUUPB-WJPDYIDTSA-N
MW129.11 g/mol
LogP0.48
Rot. Bonds2

About (E,2E)-2-hydroxyiminopent-3-enoic acid

(E,2E)-2-hydroxyiminopent-3-enoic acid (PubChem CID 88755648) has the molecular formula C5H7NO3 and a molecular weight of 129.11 g/mol. Its IUPAC name is (E,2E)-2-hydroxyiminopent-3-enoic acid.

Molecular Properties

Compound Name(E,2E)-2-hydroxyiminopent-3-enoic acid
PubChem CID88755648
Molecular FormulaC5H7NO3
Molecular Weight129.11 g/mol
Exact Mass129.04
IUPAC Name(E,2E)-2-hydroxyiminopent-3-enoic acid
SMILESC/C=C/C(=N\O)C(=O)O
InChIInChI=1S/C5H7NO3/c1-2-3-4(6-9)5(7)8/h2-3,9H,1H3,(H,7,8)/b3-2+,6-4+
InChIKeyMJMZCXUAGYUUPB-WJPDYIDTSA-N
XLogP0.48
TPSA69.89 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms9
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500129.11
LogP ≤ 50.48
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze (E,2E)-2-hydroxyiminopent-3-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (E,2E)-2-hydroxyiminopent-3-enoic acid?
The IUPAC name of (E,2E)-2-hydroxyiminopent-3-enoic acid (CID 88755648) is (E,2E)-2-hydroxyiminopent-3-enoic acid.
What is the SMILES notation for (E,2E)-2-hydroxyiminopent-3-enoic acid?
The canonical SMILES for (E,2E)-2-hydroxyiminopent-3-enoic acid is C/C=C/C(=N\O)C(=O)O.
What is the InChIKey of (E,2E)-2-hydroxyiminopent-3-enoic acid?
The InChIKey is MJMZCXUAGYUUPB-WJPDYIDTSA-N. The full InChI is InChI=1S/C5H7NO3/c1-2-3-4(6-9)5(7)8/h2-3,9H,1H3,(H,7,8)/b3-2+,6-4+.
What are the key properties of (E,2E)-2-hydroxyiminopent-3-enoic acid?
(E,2E)-2-hydroxyiminopent-3-enoic acid has a molecular weight of 129.11 g/mol, XLogP of 0.48, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E,2E)-2-hydroxyiminopent-3-enoic acid is sourced from PubChem (CID 88755648), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).