About manganese(2+);N-[2-[2-(sulfidocarbothioylamino)ethoxy]ethyl]carbamodithioate
manganese(2+);N-[2-[2-(sulfidocarbothioylamino)ethoxy]ethyl]carbamodithioate (PubChem CID 88755813) has the molecular formula C6H10MnN2OS4
and a molecular weight of 309.37 g/mol. Its IUPAC name is manganese(2+);N-[2-[2-(sulfidocarbothioylamino)ethoxy]ethyl]carbamodithioate.
Molecular Properties
| Compound Name | manganese(2+);N-[2-[2-(sulfidocarbothioylamino)ethoxy]ethyl]carbamodithioate |
| PubChem CID | 88755813 |
| Molecular Formula | C6H10MnN2OS4 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 308.91 |
| IUPAC Name | manganese(2+);N-[2-[2-(sulfidocarbothioylamino)ethoxy]ethyl]carbamodithioate |
| SMILES | S=C([S-])NCCOCCNC(=S)[S-].[Mn+2] |
| InChI | InChI=1S/C6H12N2OS4.Mn/c10-5(11)7-1-3-9-4-2-8-6(12)13;/h1-4H2,(H2,7,10,11)(H2,8,12,13);/q;+2/p-2 |
| InChIKey | ZJMKCMAXNNIBBS-UHFFFAOYSA-L |
| XLogP | -0.16 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze manganese(2+);N-[2-[2-(sulfidocarbothioylamino)ethoxy]ethyl]carbamodithioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of manganese(2+);N-[2-[2-(sulfidocarbothioylamino)ethoxy]ethyl]carbamodithioate?
The IUPAC name of manganese(2+);N-[2-[2-(sulfidocarbothioylamino)ethoxy]ethyl]carbamodithioate (CID 88755813) is manganese(2+);N-[2-[2-(sulfidocarbothioylamino)ethoxy]ethyl]carbamodithioate.
What is the SMILES notation for manganese(2+);N-[2-[2-(sulfidocarbothioylamino)ethoxy]ethyl]carbamodithioate?
The canonical SMILES for manganese(2+);N-[2-[2-(sulfidocarbothioylamino)ethoxy]ethyl]carbamodithioate is S=C([S-])NCCOCCNC(=S)[S-].[Mn+2].
What is the InChIKey of manganese(2+);N-[2-[2-(sulfidocarbothioylamino)ethoxy]ethyl]carbamodithioate?
The InChIKey is ZJMKCMAXNNIBBS-UHFFFAOYSA-L. The full InChI is InChI=1S/C6H12N2OS4.Mn/c10-5(11)7-1-3-9-4-2-8-6(12)13;/h1-4H2,(H2,7,10,11)(H2,8,12,13);/q;+2/p-2.
What are the key properties of manganese(2+);N-[2-[2-(sulfidocarbothioylamino)ethoxy]ethyl]carbamodithioate?
manganese(2+);N-[2-[2-(sulfidocarbothioylamino)ethoxy]ethyl]carbamodithioate has a molecular weight of 309.37 g/mol, XLogP of -0.16, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for manganese(2+);N-[2-[2-(sulfidocarbothioylamino)ethoxy]ethyl]carbamodithioate is sourced from PubChem (CID 88755813), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).