About 7-(3-methyloxiran-2-yl)oxy-2,3-dihydroinden-1-one
7-(3-methyloxiran-2-yl)oxy-2,3-dihydroinden-1-one (PubChem CID 88755858) has the molecular formula C12H12O3
and a molecular weight of 204.22 g/mol. Its IUPAC name is 7-(3-methyloxiran-2-yl)oxy-2,3-dihydroinden-1-one.
Molecular Properties
| Compound Name | 7-(3-methyloxiran-2-yl)oxy-2,3-dihydroinden-1-one |
| PubChem CID | 88755858 |
| Molecular Formula | C12H12O3 |
| Molecular Weight | 204.22 g/mol |
| Exact Mass | 204.08 |
| IUPAC Name | 7-(3-methyloxiran-2-yl)oxy-2,3-dihydroinden-1-one |
| SMILES | CC1OC1Oc1cccc2c1C(=O)CC2 |
| InChI | InChI=1S/C12H12O3/c1-7-12(14-7)15-10-4-2-3-8-5-6-9(13)11(8)10/h2-4,7,12H,5-6H2,1H3 |
| InChIKey | QHOYCKQEFQFVHN-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.22 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 7-(3-methyloxiran-2-yl)oxy-2,3-dihydroinden-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(3-methyloxiran-2-yl)oxy-2,3-dihydroinden-1-one?
The IUPAC name of 7-(3-methyloxiran-2-yl)oxy-2,3-dihydroinden-1-one (CID 88755858) is 7-(3-methyloxiran-2-yl)oxy-2,3-dihydroinden-1-one.
What is the SMILES notation for 7-(3-methyloxiran-2-yl)oxy-2,3-dihydroinden-1-one?
The canonical SMILES for 7-(3-methyloxiran-2-yl)oxy-2,3-dihydroinden-1-one is CC1OC1Oc1cccc2c1C(=O)CC2.
What is the InChIKey of 7-(3-methyloxiran-2-yl)oxy-2,3-dihydroinden-1-one?
The InChIKey is QHOYCKQEFQFVHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12O3/c1-7-12(14-7)15-10-4-2-3-8-5-6-9(13)11(8)10/h2-4,7,12H,5-6H2,1H3.
What are the key properties of 7-(3-methyloxiran-2-yl)oxy-2,3-dihydroinden-1-one?
7-(3-methyloxiran-2-yl)oxy-2,3-dihydroinden-1-one has a molecular weight of 204.22 g/mol, XLogP of 1.94, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(3-methyloxiran-2-yl)oxy-2,3-dihydroinden-1-one is sourced from PubChem (CID 88755858), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).