About 3H-1,2,3-benzodithiazol-3-ium chloride
3H-1,2,3-benzodithiazol-3-ium chloride (PubChem CID 88755983) has the molecular formula C6H6ClNS2
and a molecular weight of 191.71 g/mol. Its IUPAC name is 3H-1,2,3-benzodithiazol-3-ium chloride.
Molecular Properties
| Compound Name | 3H-1,2,3-benzodithiazol-3-ium chloride |
| PubChem CID | 88755983 |
| Molecular Formula | C6H6ClNS2 |
| Molecular Weight | 191.71 g/mol |
| Exact Mass | 190.96 |
| IUPAC Name | 3H-1,2,3-benzodithiazol-3-ium chloride |
| SMILES | [Cl-].c1ccc2c(c1)[NH2+]SS2 |
| InChI | InChI=1S/C6H5NS2.ClH/c1-2-4-6-5(3-1)7-9-8-6;/h1-4,7H;1H |
| InChIKey | MBHYGEPCCFYAQH-UHFFFAOYSA-N |
| XLogP | -1.45 |
| TPSA | 16.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.71 |
| LogP ≤ 5 | -1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3H-1,2,3-benzodithiazol-3-ium chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3H-1,2,3-benzodithiazol-3-ium chloride?
The IUPAC name of 3H-1,2,3-benzodithiazol-3-ium chloride (CID 88755983) is 3H-1,2,3-benzodithiazol-3-ium chloride.
What is the SMILES notation for 3H-1,2,3-benzodithiazol-3-ium chloride?
The canonical SMILES for 3H-1,2,3-benzodithiazol-3-ium chloride is [Cl-].c1ccc2c(c1)[NH2+]SS2.
What is the InChIKey of 3H-1,2,3-benzodithiazol-3-ium chloride?
The InChIKey is MBHYGEPCCFYAQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5NS2.ClH/c1-2-4-6-5(3-1)7-9-8-6;/h1-4,7H;1H.
What are the key properties of 3H-1,2,3-benzodithiazol-3-ium chloride?
3H-1,2,3-benzodithiazol-3-ium chloride has a molecular weight of 191.71 g/mol, XLogP of -1.45, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3H-1,2,3-benzodithiazol-3-ium chloride is sourced from PubChem (CID 88755983), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).