C10H14O4 — CID 88756063
2-hepta-1,6-dien-4-ylpropanedioic acid (PubChem CID 88756063) has the molecular formula C10H14O4 and a molecular weight of 198.22 g/mol. Its IUPAC name is 2-hepta-1,6-dien-4-ylpropanedioic acid.
| Compound Name | 2-hepta-1,6-dien-4-ylpropanedioic acid |
|---|---|
| PubChem CID | 88756063 |
| Molecular Formula | C10H14O4 |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.09 |
| IUPAC Name | 2-hepta-1,6-dien-4-ylpropanedioic acid |
| SMILES | C=CCC(CC=C)C(C(=O)O)C(=O)O |
| InChI | InChI=1S/C10H14O4/c1-3-5-7(6-4-2)8(9(11)12)10(13)14/h3-4,7-8H,1-2,5-6H2,(H,11,12)(H,13,14) |
| InChIKey | CKCQTOOPIYLEIR-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|