About 3-(1-buta-1,3-dienyl-1-ethenyl-2-oxopyrrolidin-1-ium-3-yl)prop-2-enoic acid;butyl prop-2-enoate
3-(1-buta-1,3-dienyl-1-ethenyl-2-oxopyrrolidin-1-ium-3-yl)prop-2-enoic acid;butyl prop-2-enoate (PubChem CID 88756186) has the molecular formula C20H28NO5+
and a molecular weight of 362.45 g/mol. Its IUPAC name is 3-(1-buta-1,3-dienyl-1-ethenyl-2-oxopyrrolidin-1-ium-3-yl)prop-2-enoic acid;butyl prop-2-enoate.
Molecular Properties
| Compound Name | 3-(1-buta-1,3-dienyl-1-ethenyl-2-oxopyrrolidin-1-ium-3-yl)prop-2-enoic acid;butyl prop-2-enoate |
| PubChem CID | 88756186 |
| Molecular Formula | C20H28NO5+ |
| Molecular Weight | 362.45 g/mol |
| Exact Mass | 362.20 |
| IUPAC Name | 3-(1-buta-1,3-dienyl-1-ethenyl-2-oxopyrrolidin-1-ium-3-yl)prop-2-enoic acid;butyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCC.C=CC=C[N+]1(C=C)CCC(C=CC(=O)O)C1=O |
| InChI | InChI=1S/C13H15NO3.C7H12O2/c1-3-5-9-14(4-2)10-8-11(13(14)17)6-7-12(15)16;1-3-5-6-9-7(8)4-2/h3-7,9,11H,1-2,8,10H2;4H,2-3,5-6H2,1H3/p+1 |
| InChIKey | DLTHTNYYXMWJSX-UHFFFAOYSA-O |
| XLogP | 3.35 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.45 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 3-(1-buta-1,3-dienyl-1-ethenyl-2-oxopyrrolidin-1-ium-3-yl)prop-2-enoic acid;butyl prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1-buta-1,3-dienyl-1-ethenyl-2-oxopyrrolidin-1-ium-3-yl)prop-2-enoic acid;butyl prop-2-enoate?
The IUPAC name of 3-(1-buta-1,3-dienyl-1-ethenyl-2-oxopyrrolidin-1-ium-3-yl)prop-2-enoic acid;butyl prop-2-enoate (CID 88756186) is 3-(1-buta-1,3-dienyl-1-ethenyl-2-oxopyrrolidin-1-ium-3-yl)prop-2-enoic acid;butyl prop-2-enoate.
What is the SMILES notation for 3-(1-buta-1,3-dienyl-1-ethenyl-2-oxopyrrolidin-1-ium-3-yl)prop-2-enoic acid;butyl prop-2-enoate?
The canonical SMILES for 3-(1-buta-1,3-dienyl-1-ethenyl-2-oxopyrrolidin-1-ium-3-yl)prop-2-enoic acid;butyl prop-2-enoate is C=CC(=O)OCCCC.C=CC=C[N+]1(C=C)CCC(C=CC(=O)O)C1=O.
What is the InChIKey of 3-(1-buta-1,3-dienyl-1-ethenyl-2-oxopyrrolidin-1-ium-3-yl)prop-2-enoic acid;butyl prop-2-enoate?
The InChIKey is DLTHTNYYXMWJSX-UHFFFAOYSA-O. The full InChI is InChI=1S/C13H15NO3.C7H12O2/c1-3-5-9-14(4-2)10-8-11(13(14)17)6-7-12(15)16;1-3-5-6-9-7(8)4-2/h3-7,9,11H,1-2,8,10H2;4H,2-3,5-6H2,1H3/p+1.
What are the key properties of 3-(1-buta-1,3-dienyl-1-ethenyl-2-oxopyrrolidin-1-ium-3-yl)prop-2-enoic acid;butyl prop-2-enoate?
3-(1-buta-1,3-dienyl-1-ethenyl-2-oxopyrrolidin-1-ium-3-yl)prop-2-enoic acid;butyl prop-2-enoate has a molecular weight of 362.45 g/mol, XLogP of 3.35, 9 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1-buta-1,3-dienyl-1-ethenyl-2-oxopyrrolidin-1-ium-3-yl)prop-2-enoic acid;butyl prop-2-enoate is sourced from PubChem (CID 88756186), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).