About 6-hydroxy-2,3,4-tris(hydroxymethyl)benzaldehyde
6-hydroxy-2,3,4-tris(hydroxymethyl)benzaldehyde (PubChem CID 88756887) has the molecular formula C10H12O5
and a molecular weight of 212.20 g/mol. Its IUPAC name is 6-hydroxy-2,3,4-tris(hydroxymethyl)benzaldehyde.
Molecular Properties
| Compound Name | 6-hydroxy-2,3,4-tris(hydroxymethyl)benzaldehyde |
| PubChem CID | 88756887 |
| Molecular Formula | C10H12O5 |
| Molecular Weight | 212.20 g/mol |
| Exact Mass | 212.07 |
| IUPAC Name | 6-hydroxy-2,3,4-tris(hydroxymethyl)benzaldehyde |
| SMILES | O=Cc1c(O)cc(CO)c(CO)c1CO |
| InChI | InChI=1S/C10H12O5/c11-2-6-1-10(15)9(5-14)8(4-13)7(6)3-12/h1,5,11-13,15H,2-4H2 |
| InChIKey | XYDATHVLPNRIIG-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.20 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 6-hydroxy-2,3,4-tris(hydroxymethyl)benzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-hydroxy-2,3,4-tris(hydroxymethyl)benzaldehyde?
The IUPAC name of 6-hydroxy-2,3,4-tris(hydroxymethyl)benzaldehyde (CID 88756887) is 6-hydroxy-2,3,4-tris(hydroxymethyl)benzaldehyde.
What is the SMILES notation for 6-hydroxy-2,3,4-tris(hydroxymethyl)benzaldehyde?
The canonical SMILES for 6-hydroxy-2,3,4-tris(hydroxymethyl)benzaldehyde is O=Cc1c(O)cc(CO)c(CO)c1CO.
What is the InChIKey of 6-hydroxy-2,3,4-tris(hydroxymethyl)benzaldehyde?
The InChIKey is XYDATHVLPNRIIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12O5/c11-2-6-1-10(15)9(5-14)8(4-13)7(6)3-12/h1,5,11-13,15H,2-4H2.
What are the key properties of 6-hydroxy-2,3,4-tris(hydroxymethyl)benzaldehyde?
6-hydroxy-2,3,4-tris(hydroxymethyl)benzaldehyde has a molecular weight of 212.20 g/mol, XLogP of -0.32, 4 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-hydroxy-2,3,4-tris(hydroxymethyl)benzaldehyde is sourced from PubChem (CID 88756887), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).