C9H17F3N3O6P — CID 88757173
2-[[bis(ethylamino)-phosphonomethyl]-(2,2,2-trifluoroacetyl)amino]acetic acid (PubChem CID 88757173) has the molecular formula C9H17F3N3O6P and a molecular weight of 351.22 g/mol. Its IUPAC name is 2-[[bis(ethylamino)-phosphonomethyl]-(2,2,2-trifluoroacetyl)amino]acetic acid.
| Compound Name | 2-[[bis(ethylamino)-phosphonomethyl]-(2,2,2-trifluoroacetyl)amino]acetic acid |
|---|---|
| PubChem CID | 88757173 |
| Molecular Formula | C9H17F3N3O6P |
| Molecular Weight | 351.22 g/mol |
| Exact Mass | 351.08 |
| IUPAC Name | 2-[[bis(ethylamino)-phosphonomethyl]-(2,2,2-trifluoroacetyl)amino]acetic acid |
| SMILES | CCNC(NCC)(N(CC(=O)O)C(=O)C(F)(F)F)P(=O)(O)O |
| InChI | InChI=1S/C9H17F3N3O6P/c1-3-13-9(14-4-2,22(19,20)21)15(5-6(16)17)7(18)8(10,11)12/h13-14H,3-5H2,1-2H3,(H,16,17)(H2,19,20,21) |
| InChIKey | ZOHHXZAJJIAZNX-UHFFFAOYSA-N |
| XLogP | -0.53 |
| TPSA | 139.20 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.22 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|