C23H17BrClF2N3O2 — CID 88757204
5-(4-bromo-3,5-difluoro-2-methoxyphenyl)-N-(4-chlorophenyl)-4-phenyl-3,4-dihydropyrazole-2-carboxamide (PubChem CID 88757204) has the molecular formula C23H17BrClF2N3O2 and a molecular weight of 520.76 g/mol. Its IUPAC name is 5-(4-bromo-3,5-difluoro-2-methoxyphenyl)-N-(4-chlorophenyl)-4-phenyl-3,4-dihydropyrazole-2-carboxamide.
| Compound Name | 5-(4-bromo-3,5-difluoro-2-methoxyphenyl)-N-(4-chlorophenyl)-4-phenyl-3,4-dihydropyrazole-2-carboxamide |
|---|---|
| PubChem CID | 88757204 |
| Molecular Formula | C23H17BrClF2N3O2 |
| Molecular Weight | 520.76 g/mol |
| Exact Mass | 519.02 |
| IUPAC Name | 5-(4-bromo-3,5-difluoro-2-methoxyphenyl)-N-(4-chlorophenyl)-4-phenyl-3,4-dihydropyrazole-2-carboxamide |
| SMILES | COc1c(C2=NN(C(=O)Nc3ccc(Cl)cc3)CC2c2ccccc2)cc(F)c(Br)c1F |
| InChI | InChI=1S/C23H17BrClF2N3O2/c1-32-22-16(11-18(26)19(24)20(22)27)21-17(13-5-3-2-4-6-13)12-30(29-21)23(31)28-15-9-7-14(25)8-10-15/h2-11,17H,12H2,1H3,(H,28,31) |
| InChIKey | BNJKRNZQVUYUPK-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.76 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|