C15Cl30 — CID 88757589
1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10-nonadecachloro-10-(1,1,2,2,3,3,4,4,5,5,5-undecachloropentyl)cyclodecane (PubChem CID 88757589) has the molecular formula C15Cl30 and a molecular weight of 1243.75 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10-nonadecachloro-10-(1,1,2,2,3,3,4,4,5,5,5-undecachloropentyl)cyclodecane.
| Compound Name | 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10-nonadecachloro-10-(1,1,2,2,3,3,4,4,5,5,5-undecachloropentyl)cyclodecane |
|---|---|
| PubChem CID | 88757589 |
| Molecular Formula | C15Cl30 |
| Molecular Weight | 1243.75 g/mol |
| Exact Mass | 1229.07 |
| IUPAC Name | 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10-nonadecachloro-10-(1,1,2,2,3,3,4,4,5,5,5-undecachloropentyl)cyclodecane |
| SMILES | ClC(Cl)(Cl)C(Cl)(Cl)C(Cl)(Cl)C(Cl)(Cl)C(Cl)(Cl)C1(Cl)C(Cl)(Cl)C(Cl)(Cl)C(Cl)(Cl)C(Cl)(Cl)C(Cl)(Cl)C(Cl)(Cl)C(Cl)(Cl)C(Cl)(Cl)C1(Cl)Cl |
| InChI | InChI=1S/C15Cl30/c16-1(4(21,22)7(27,28)13(39,40)14(41,42)15(43,44)45)2(17,18)5(23,24)8(29,30)10(33,34)12(37,38)11(35,36)9(31,32)6(25,26)3(1,19)20 |
| InChIKey | RELWHXJUEVLWFL-UHFFFAOYSA-N |
| XLogP | 17.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1243.75 |
| LogP ≤ 5 | 17.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|