About 2-(1,3-thiazolidin-2-ylsulfanyl)-1,3-thiazolidine
2-(1,3-thiazolidin-2-ylsulfanyl)-1,3-thiazolidine (PubChem CID 88757972) has the molecular formula C6H12N2S3
and a molecular weight of 208.38 g/mol. Its IUPAC name is 2-(1,3-thiazolidin-2-ylsulfanyl)-1,3-thiazolidine.
Molecular Properties
| Compound Name | 2-(1,3-thiazolidin-2-ylsulfanyl)-1,3-thiazolidine |
| PubChem CID | 88757972 |
| Molecular Formula | C6H12N2S3 |
| Molecular Weight | 208.38 g/mol |
| Exact Mass | 208.02 |
| IUPAC Name | 2-(1,3-thiazolidin-2-ylsulfanyl)-1,3-thiazolidine |
| SMILES | C1CSC(SC2NCCS2)N1 |
| InChI | InChI=1S/C6H12N2S3/c1-3-9-5(7-1)11-6-8-2-4-10-6/h5-8H,1-4H2 |
| InChIKey | BPMLFAYOUVGZIK-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.38 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(1,3-thiazolidin-2-ylsulfanyl)-1,3-thiazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,3-thiazolidin-2-ylsulfanyl)-1,3-thiazolidine?
The IUPAC name of 2-(1,3-thiazolidin-2-ylsulfanyl)-1,3-thiazolidine (CID 88757972) is 2-(1,3-thiazolidin-2-ylsulfanyl)-1,3-thiazolidine.
What is the SMILES notation for 2-(1,3-thiazolidin-2-ylsulfanyl)-1,3-thiazolidine?
The canonical SMILES for 2-(1,3-thiazolidin-2-ylsulfanyl)-1,3-thiazolidine is C1CSC(SC2NCCS2)N1.
What is the InChIKey of 2-(1,3-thiazolidin-2-ylsulfanyl)-1,3-thiazolidine?
The InChIKey is BPMLFAYOUVGZIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N2S3/c1-3-9-5(7-1)11-6-8-2-4-10-6/h5-8H,1-4H2.
What are the key properties of 2-(1,3-thiazolidin-2-ylsulfanyl)-1,3-thiazolidine?
2-(1,3-thiazolidin-2-ylsulfanyl)-1,3-thiazolidine has a molecular weight of 208.38 g/mol, XLogP of 0.96, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,3-thiazolidin-2-ylsulfanyl)-1,3-thiazolidine is sourced from PubChem (CID 88757972), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).