About prop-2-ene-1,2-dithiol
prop-2-ene-1,2-dithiol (PubChem CID 88758068) has the molecular formula C3H6S2
and a molecular weight of 106.21 g/mol. Its IUPAC name is prop-2-ene-1,2-dithiol.
Molecular Properties
| Compound Name | prop-2-ene-1,2-dithiol |
| PubChem CID | 88758068 |
| Molecular Formula | C3H6S2 |
| Molecular Weight | 106.21 g/mol |
| Exact Mass | 105.99 |
| IUPAC Name | prop-2-ene-1,2-dithiol |
| SMILES | C=C(S)CS |
| InChI | InChI=1S/C3H6S2/c1-3(5)2-4/h4-5H,1-2H2 |
| InChIKey | PJJVRQWZSWRULF-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 106.21 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze prop-2-ene-1,2-dithiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of prop-2-ene-1,2-dithiol?
The IUPAC name of prop-2-ene-1,2-dithiol (CID 88758068) is prop-2-ene-1,2-dithiol.
What is the SMILES notation for prop-2-ene-1,2-dithiol?
The canonical SMILES for prop-2-ene-1,2-dithiol is C=C(S)CS.
What is the InChIKey of prop-2-ene-1,2-dithiol?
The InChIKey is PJJVRQWZSWRULF-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H6S2/c1-3(5)2-4/h4-5H,1-2H2.
What are the key properties of prop-2-ene-1,2-dithiol?
prop-2-ene-1,2-dithiol has a molecular weight of 106.21 g/mol, XLogP of 1.36, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for prop-2-ene-1,2-dithiol is sourced from PubChem (CID 88758068), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).