C8H5F9O — CID 88758199
2-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)-2,5-dihydrofuran (PubChem CID 88758199) has the molecular formula C8H5F9O and a molecular weight of 288.11 g/mol. Its IUPAC name is 2-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)-2,5-dihydrofuran.
| Compound Name | 2-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)-2,5-dihydrofuran |
|---|---|
| PubChem CID | 88758199 |
| Molecular Formula | C8H5F9O |
| Molecular Weight | 288.11 g/mol |
| Exact Mass | 288.02 |
| IUPAC Name | 2-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)-2,5-dihydrofuran |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C1C=CCO1 |
| InChI | InChI=1S/C8H5F9O/c9-5(10,4-2-1-3-18-4)6(11,12)7(13,14)8(15,16)17/h1-2,4H,3H2 |
| InChIKey | ACCUDQXQRIMOSK-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.11 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|