C20H36O6Sn — CID 88759898
1-O-(2-acetyloxyethyl) 4-O-tributylstannyl (Z)-but-2-enedioate (PubChem CID 88759898) has the molecular formula C20H36O6Sn and a molecular weight of 491.21 g/mol. Its IUPAC name is 1-O-(2-acetyloxyethyl) 4-O-tributylstannyl (Z)-but-2-enedioate.
| Compound Name | 1-O-(2-acetyloxyethyl) 4-O-tributylstannyl (Z)-but-2-enedioate |
|---|---|
| PubChem CID | 88759898 |
| Molecular Formula | C20H36O6Sn |
| Molecular Weight | 491.21 g/mol |
| Exact Mass | 492.15 |
| IUPAC Name | 1-O-(2-acetyloxyethyl) 4-O-tributylstannyl (Z)-but-2-enedioate |
| SMILES | CCCC[Sn](CCCC)(CCCC)OC(=O)/C=C\C(=O)OCCOC(C)=O |
| InChI | InChI=1S/C8H10O6.3C4H9.Sn/c1-6(9)13-4-5-14-8(12)3-2-7(10)11;3*1-3-4-2;/h2-3H,4-5H2,1H3,(H,10,11);3*1,3-4H2,2H3;/q;;;;+1/p-1/b3-2-;;;; |
| InChIKey | AYQZDZVPDQGOMB-RFTJRDPSSA-M |
| XLogP | 4.54 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.21 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|