C25H30ClF3O5 — CID 88760068
[(8S,9R,10S,13S,14S,17R)-7-chloro-6,9-difluoro-17-(2-fluoroacetyl)-11-hydroxy-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl] propanoate (PubChem CID 88760068) has the molecular formula C25H30ClF3O5 and a molecular weight of 502.96 g/mol. Its IUPAC name is [(8S,9R,10S,13S,14S,17R)-7-chloro-6,9-difluoro-17-(2-fluoroacetyl)-11-hydroxy-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl] propanoate.
| Compound Name | [(8S,9R,10S,13S,14S,17R)-7-chloro-6,9-difluoro-17-(2-fluoroacetyl)-11-hydroxy-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl] propanoate |
|---|---|
| PubChem CID | 88760068 |
| Molecular Formula | C25H30ClF3O5 |
| Molecular Weight | 502.96 g/mol |
| Exact Mass | 502.17 |
| IUPAC Name | [(8S,9R,10S,13S,14S,17R)-7-chloro-6,9-difluoro-17-(2-fluoroacetyl)-11-hydroxy-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl] propanoate |
| SMILES | CCC(=O)O[C@]1(C(=O)CF)C(C)C[C@H]2[C@@H]3C(Cl)C(F)C4=CC(=O)C=C[C@]4(C)[C@@]3(F)C(O)C[C@@]21C |
| InChI | InChI=1S/C25H30ClF3O5/c1-5-18(33)34-25(17(32)11-27)12(2)8-14-19-20(26)21(28)15-9-13(30)6-7-22(15,3)24(19,29)16(31)10-23(14,25)4/h6-7,9,12,14,16,19-21,31H,5,8,10-11H2,1-4H3/t12?,14-,16?,19+,20?,21?,22-,23-,24+,25-/m0/s1 |
| InChIKey | LCTVWDLHOMTODL-QQALQYNMSA-N |
| XLogP | 4.00 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.96 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|