1,1-dichloropent-1-en-2-yloxy(prop-2-enyl)phosphinic acid

C8H13Cl2O3P — CID 88760210

IUPAC1,1-dichloropent-1-en-2-yloxy(prop-2-enyl)phosphinic acid
SMILESC=CCP(=O)(O)OC(CCC)=C(Cl)Cl
InChIInChI=1S/C8H13Cl2O3P/c1-3-5-7(8(9)10)13-14(11,12)6-4-2/h4H,2-3,5-6H2,1H3,(H,11,12)
InChIKeyOADUKUSIZPLWID-UHFFFAOYSA-N
MW259.07 g/mol
LogP3.82
Rot. Bonds6

About 1,1-dichloropent-1-en-2-yloxy(prop-2-enyl)phosphinic acid

1,1-dichloropent-1-en-2-yloxy(prop-2-enyl)phosphinic acid (PubChem CID 88760210) has the molecular formula C8H13Cl2O3P and a molecular weight of 259.07 g/mol. Its IUPAC name is 1,1-dichloropent-1-en-2-yloxy(prop-2-enyl)phosphinic acid.

Molecular Properties

Compound Name1,1-dichloropent-1-en-2-yloxy(prop-2-enyl)phosphinic acid
PubChem CID88760210
Molecular FormulaC8H13Cl2O3P
Molecular Weight259.07 g/mol
Exact Mass258.00
IUPAC Name1,1-dichloropent-1-en-2-yloxy(prop-2-enyl)phosphinic acid
SMILESC=CCP(=O)(O)OC(CCC)=C(Cl)Cl
InChIInChI=1S/C8H13Cl2O3P/c1-3-5-7(8(9)10)13-14(11,12)6-4-2/h4H,2-3,5-6H2,1H3,(H,11,12)
InChIKeyOADUKUSIZPLWID-UHFFFAOYSA-N
XLogP3.82
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds6
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500259.07
LogP ≤ 53.82
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}

Analyze 1,1-dichloropent-1-en-2-yloxy(prop-2-enyl)phosphinic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1,1-dichloropent-1-en-2-yloxy(prop-2-enyl)phosphinic acid?
The IUPAC name of 1,1-dichloropent-1-en-2-yloxy(prop-2-enyl)phosphinic acid (CID 88760210) is 1,1-dichloropent-1-en-2-yloxy(prop-2-enyl)phosphinic acid.
What is the SMILES notation for 1,1-dichloropent-1-en-2-yloxy(prop-2-enyl)phosphinic acid?
The canonical SMILES for 1,1-dichloropent-1-en-2-yloxy(prop-2-enyl)phosphinic acid is C=CCP(=O)(O)OC(CCC)=C(Cl)Cl.
What is the InChIKey of 1,1-dichloropent-1-en-2-yloxy(prop-2-enyl)phosphinic acid?
The InChIKey is OADUKUSIZPLWID-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13Cl2O3P/c1-3-5-7(8(9)10)13-14(11,12)6-4-2/h4H,2-3,5-6H2,1H3,(H,11,12).
What are the key properties of 1,1-dichloropent-1-en-2-yloxy(prop-2-enyl)phosphinic acid?
1,1-dichloropent-1-en-2-yloxy(prop-2-enyl)phosphinic acid has a molecular weight of 259.07 g/mol, XLogP of 3.82, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-dichloropent-1-en-2-yloxy(prop-2-enyl)phosphinic acid is sourced from PubChem (CID 88760210), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).