About 2,2-dichloroethenyl prop-2-enyl propyl phosphate
2,2-dichloroethenyl prop-2-enyl propyl phosphate (PubChem CID 88760409) has the molecular formula C8H13Cl2O4P
and a molecular weight of 275.07 g/mol. Its IUPAC name is 2,2-dichloroethenyl prop-2-enyl propyl phosphate.
Molecular Properties
| Compound Name | 2,2-dichloroethenyl prop-2-enyl propyl phosphate |
| PubChem CID | 88760409 |
| Molecular Formula | C8H13Cl2O4P |
| Molecular Weight | 275.07 g/mol |
| Exact Mass | 273.99 |
| IUPAC Name | 2,2-dichloroethenyl prop-2-enyl propyl phosphate |
| SMILES | C=CCOP(=O)(OC=C(Cl)Cl)OCCC |
| InChI | InChI=1S/C8H13Cl2O4P/c1-3-5-12-15(11,13-6-4-2)14-7-8(9)10/h3,7H,1,4-6H2,2H3 |
| InChIKey | NMTDLIJVZCYGQV-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.07 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2,2-dichloroethenyl prop-2-enyl propyl phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dichloroethenyl prop-2-enyl propyl phosphate?
The IUPAC name of 2,2-dichloroethenyl prop-2-enyl propyl phosphate (CID 88760409) is 2,2-dichloroethenyl prop-2-enyl propyl phosphate.
What is the SMILES notation for 2,2-dichloroethenyl prop-2-enyl propyl phosphate?
The canonical SMILES for 2,2-dichloroethenyl prop-2-enyl propyl phosphate is C=CCOP(=O)(OC=C(Cl)Cl)OCCC.
What is the InChIKey of 2,2-dichloroethenyl prop-2-enyl propyl phosphate?
The InChIKey is NMTDLIJVZCYGQV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13Cl2O4P/c1-3-5-12-15(11,13-6-4-2)14-7-8(9)10/h3,7H,1,4-6H2,2H3.
What are the key properties of 2,2-dichloroethenyl prop-2-enyl propyl phosphate?
2,2-dichloroethenyl prop-2-enyl propyl phosphate has a molecular weight of 275.07 g/mol, XLogP of 4.02, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dichloroethenyl prop-2-enyl propyl phosphate is sourced from PubChem (CID 88760409), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).