About 1-methyl-3-[2-[methyl(1,3-thiazol-5-yl)amino]ethylsulfanyl]urea
1-methyl-3-[2-[methyl(1,3-thiazol-5-yl)amino]ethylsulfanyl]urea (PubChem CID 88760684) has the molecular formula C8H14N4OS2
and a molecular weight of 246.36 g/mol. Its IUPAC name is 1-methyl-3-[2-[methyl(1,3-thiazol-5-yl)amino]ethylsulfanyl]urea.
Molecular Properties
| Compound Name | 1-methyl-3-[2-[methyl(1,3-thiazol-5-yl)amino]ethylsulfanyl]urea |
| PubChem CID | 88760684 |
| Molecular Formula | C8H14N4OS2 |
| Molecular Weight | 246.36 g/mol |
| Exact Mass | 246.06 |
| IUPAC Name | 1-methyl-3-[2-[methyl(1,3-thiazol-5-yl)amino]ethylsulfanyl]urea |
| SMILES | CNC(=O)NSCCN(C)c1cncs1 |
| InChI | InChI=1S/C8H14N4OS2/c1-9-8(13)11-15-4-3-12(2)7-5-10-6-14-7/h5-6H,3-4H2,1-2H3,(H2,9,11,13) |
| InChIKey | ARTFJVLVDGJOID-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.36 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-methyl-3-[2-[methyl(1,3-thiazol-5-yl)amino]ethylsulfanyl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-3-[2-[methyl(1,3-thiazol-5-yl)amino]ethylsulfanyl]urea?
The IUPAC name of 1-methyl-3-[2-[methyl(1,3-thiazol-5-yl)amino]ethylsulfanyl]urea (CID 88760684) is 1-methyl-3-[2-[methyl(1,3-thiazol-5-yl)amino]ethylsulfanyl]urea.
What is the SMILES notation for 1-methyl-3-[2-[methyl(1,3-thiazol-5-yl)amino]ethylsulfanyl]urea?
The canonical SMILES for 1-methyl-3-[2-[methyl(1,3-thiazol-5-yl)amino]ethylsulfanyl]urea is CNC(=O)NSCCN(C)c1cncs1.
What is the InChIKey of 1-methyl-3-[2-[methyl(1,3-thiazol-5-yl)amino]ethylsulfanyl]urea?
The InChIKey is ARTFJVLVDGJOID-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N4OS2/c1-9-8(13)11-15-4-3-12(2)7-5-10-6-14-7/h5-6H,3-4H2,1-2H3,(H2,9,11,13).
What are the key properties of 1-methyl-3-[2-[methyl(1,3-thiazol-5-yl)amino]ethylsulfanyl]urea?
1-methyl-3-[2-[methyl(1,3-thiazol-5-yl)amino]ethylsulfanyl]urea has a molecular weight of 246.36 g/mol, XLogP of 1.16, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-3-[2-[methyl(1,3-thiazol-5-yl)amino]ethylsulfanyl]urea is sourced from PubChem (CID 88760684), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).