About 2,2-dichloroethenyl methyl prop-2-enyl phosphate
2,2-dichloroethenyl methyl prop-2-enyl phosphate (PubChem CID 88760740) has the molecular formula C6H9Cl2O4P
and a molecular weight of 247.01 g/mol. Its IUPAC name is 2,2-dichloroethenyl methyl prop-2-enyl phosphate.
Molecular Properties
| Compound Name | 2,2-dichloroethenyl methyl prop-2-enyl phosphate |
| PubChem CID | 88760740 |
| Molecular Formula | C6H9Cl2O4P |
| Molecular Weight | 247.01 g/mol |
| Exact Mass | 245.96 |
| IUPAC Name | 2,2-dichloroethenyl methyl prop-2-enyl phosphate |
| SMILES | C=CCOP(=O)(OC)OC=C(Cl)Cl |
| InChI | InChI=1S/C6H9Cl2O4P/c1-3-4-11-13(9,10-2)12-5-6(7)8/h3,5H,1,4H2,2H3 |
| InChIKey | APWQPRCDJWJLKU-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.01 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2,2-dichloroethenyl methyl prop-2-enyl phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dichloroethenyl methyl prop-2-enyl phosphate?
The IUPAC name of 2,2-dichloroethenyl methyl prop-2-enyl phosphate (CID 88760740) is 2,2-dichloroethenyl methyl prop-2-enyl phosphate.
What is the SMILES notation for 2,2-dichloroethenyl methyl prop-2-enyl phosphate?
The canonical SMILES for 2,2-dichloroethenyl methyl prop-2-enyl phosphate is C=CCOP(=O)(OC)OC=C(Cl)Cl.
What is the InChIKey of 2,2-dichloroethenyl methyl prop-2-enyl phosphate?
The InChIKey is APWQPRCDJWJLKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9Cl2O4P/c1-3-4-11-13(9,10-2)12-5-6(7)8/h3,5H,1,4H2,2H3.
What are the key properties of 2,2-dichloroethenyl methyl prop-2-enyl phosphate?
2,2-dichloroethenyl methyl prop-2-enyl phosphate has a molecular weight of 247.01 g/mol, XLogP of 3.24, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dichloroethenyl methyl prop-2-enyl phosphate is sourced from PubChem (CID 88760740), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).